C25H20F6N4O4S — CID 134151116
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-[[1-(4-methoxyphenyl)triazol-4-yl]methyl]benzenesulfonamide (PubChem CID 134151116) has the molecular formula C25H20F6N4O4S and a molecular weight of 586.51 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-[[1-(4-methoxyphenyl)triazol-4-yl]methyl]benzenesulfonamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-[[1-(4-methoxyphenyl)triazol-4-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134151116 |
| Molecular Formula | C25H20F6N4O4S |
| Molecular Weight | 586.51 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-[[1-(4-methoxyphenyl)triazol-4-yl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(-n2cc(CN(c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)S(=O)(=O)c3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C25H20F6N4O4S/c1-39-21-13-11-19(12-14-21)34-15-18(32-33-34)16-35(40(37,38)22-5-3-2-4-6-22)20-9-7-17(8-10-20)23(36,24(26,27)28)25(29,30)31/h2-15,36H,16H2,1H3 |
| InChIKey | VPSOKVXQUYWHRP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |