About 5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide
5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide (PubChem CID 134151505) has the molecular formula C31H27BrN2
and a molecular weight of 507.48 g/mol. Its IUPAC name is 5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide.
Molecular Properties
| Compound Name | 5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide |
| PubChem CID | 134151505 |
| Molecular Formula | C31H27BrN2 |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide |
| SMILES | Cc1cc2c(cc1C)[n+](Cc1ccc3ccccc3c1)cn2Cc1ccc2ccccc2c1.[Br-] |
| InChI | InChI=1S/C31H27N2.BrH/c1-22-15-30-31(16-23(22)2)33(20-25-12-14-27-8-4-6-10-29(27)18-25)21-32(30)19-24-11-13-26-7-3-5-9-28(26)17-24;/h3-18,21H,19-20H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BTYATKULVKZOBD-UHFFFAOYSA-M |
| XLogP | 3.95 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide?
The IUPAC name of 5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide (CID 134151505) is 5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide.
What is the SMILES notation for 5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide?
The canonical SMILES for 5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide is Cc1cc2c(cc1C)[n+](Cc1ccc3ccccc3c1)cn2Cc1ccc2ccccc2c1.[Br-].
What is the InChIKey of 5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide?
The InChIKey is BTYATKULVKZOBD-UHFFFAOYSA-M. The full InChI is InChI=1S/C31H27N2.BrH/c1-22-15-30-31(16-23(22)2)33(20-25-12-14-27-8-4-6-10-29(27)18-25)21-32(30)19-24-11-13-26-7-3-5-9-28(26)17-24;/h3-18,21H,19-20H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide?
5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide has a molecular weight of 507.48 g/mol, XLogP of 3.95, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-1,3-bis(naphthalen-2-ylmethyl)benzimidazol-3-ium bromide is sourced from PubChem (CID 134151505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).