C23H18ClN5O2S — CID 134151628
1-(2-chlorophenyl)-N-[(Z)-(3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 134151628) has the molecular formula C23H18ClN5O2S and a molecular weight of 463.95 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[(Z)-(3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-[(Z)-(3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 134151628 |
| Molecular Formula | C23H18ClN5O2S |
| Molecular Weight | 463.95 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[(Z)-(3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | CCN1C(=O)CS/C1=N\NC(=O)c1cc2c([nH]c3ccccc32)c(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C23H18ClN5O2S/c1-2-29-19(30)12-32-23(29)28-27-22(31)18-11-15-13-7-4-6-10-17(13)25-21(15)20(26-18)14-8-3-5-9-16(14)24/h3-11,25H,2,12H2,1H3,(H,27,31)/b28-23- |
| InChIKey | YZVDQNOMOPIMEW-NFFVHWSESA-N |
| XLogP | 4.63 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.95 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|