About N-(5,6-diaminohexyl)-3-(2-oxo-3-phenylmethoxy-1-pyridinyl)propanamide;dihydrochloride
N-(5,6-diaminohexyl)-3-(2-oxo-3-phenylmethoxy-1-pyridinyl)propanamide;dihydrochloride (PubChem CID 134151676) has the molecular formula C21H32Cl2N4O3
and a molecular weight of 459.42 g/mol. Its IUPAC name is N-(5,6-diaminohexyl)-3-(2-oxo-3-phenylmethoxy-1-pyridinyl)propanamide;dihydrochloride.
Molecular Properties
| Compound Name | N-(5,6-diaminohexyl)-3-(2-oxo-3-phenylmethoxy-1-pyridinyl)propanamide;dihydrochloride |
| PubChem CID | 134151676 |
| Molecular Formula | C21H32Cl2N4O3 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | N-(5,6-diaminohexyl)-3-(2-oxo-3-phenylmethoxy-1-pyridinyl)propanamide;dihydrochloride |
| SMILES | Cl.Cl.NCC(N)CCCCNC(=O)CCn1cccc(OCc2ccccc2)c1=O |
| InChI | InChI=1S/C21H30N4O3.2ClH/c22-15-18(23)9-4-5-12-24-20(26)11-14-25-13-6-10-19(21(25)27)28-16-17-7-2-1-3-8-17;;/h1-3,6-8,10,13,18H,4-5,9,11-12,14-16,22-23H2,(H,24,26);2*1H |
| InChIKey | NUJFHGBEACZTAA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(5,6-diaminohexyl)-3-(2-oxo-3-phenylmethoxy-1-pyridinyl)propanamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,6-diaminohexyl)-3-(2-oxo-3-phenylmethoxy-1-pyridinyl)propanamide;dihydrochloride?
The IUPAC name of N-(5,6-diaminohexyl)-3-(2-oxo-3-phenylmethoxy-1-pyridinyl)propanamide;dihydrochloride (CID 134151676) is N-(5,6-diaminohexyl)-3-(2-oxo-3-phenylmethoxy-1-pyridinyl)propanamide;dihydrochloride.
What is the SMILES notation for N-(5,6-diaminohexyl)-3-(2-oxo-3-phenylmethoxy-1-pyridinyl)propanamide;dihydrochloride?
The canonical SMILES for N-(5,6-diaminohexyl)-3-(2-oxo-3-phenylmethoxy-1-pyridinyl)propanamide;dihydrochloride is Cl.Cl.NCC(N)CCCCNC(=O)CCn1cccc(OCc2ccccc2)c1=O.
What is the InChIKey of N-(5,6-diaminohexyl)-3-(2-oxo-3-phenylmethoxy-1-pyridinyl)propanamide;dihydrochloride?
The InChIKey is NUJFHGBEACZTAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N4O3.2ClH/c22-15-18(23)9-4-5-12-24-20(26)11-14-25-13-6-10-19(21(25)27)28-16-17-7-2-1-3-8-17;;/h1-3,6-8,10,13,18H,4-5,9,11-12,14-16,22-23H2,(H,24,26);2*1H.
What are the key properties of N-(5,6-diaminohexyl)-3-(2-oxo-3-phenylmethoxy-1-pyridinyl)propanamide;dihydrochloride?
N-(5,6-diaminohexyl)-3-(2-oxo-3-phenylmethoxy-1-pyridinyl)propanamide;dihydrochloride has a molecular weight of 459.42 g/mol, XLogP of 2.23, 12 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,6-diaminohexyl)-3-(2-oxo-3-phenylmethoxy-1-pyridinyl)propanamide;dihydrochloride is sourced from PubChem (CID 134151676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).