C18H24O4 — CID 134151717
(4aR,8R,8aR)-2-(4-methoxyphenyl)-4,7-dimethyl-2,3,4a,5,8,8a-hexahydrochromene-4,8-diol (PubChem CID 134151717) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (4aR,8R,8aR)-2-(4-methoxyphenyl)-4,7-dimethyl-2,3,4a,5,8,8a-hexahydrochromene-4,8-diol.
| Compound Name | (4aR,8R,8aR)-2-(4-methoxyphenyl)-4,7-dimethyl-2,3,4a,5,8,8a-hexahydrochromene-4,8-diol |
|---|---|
| PubChem CID | 134151717 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (4aR,8R,8aR)-2-(4-methoxyphenyl)-4,7-dimethyl-2,3,4a,5,8,8a-hexahydrochromene-4,8-diol |
| SMILES | COc1ccc(C2CC(C)(O)[C@@H]3CC=C(C)[C@@H](O)[C@@H]3O2)cc1 |
| InChI | InChI=1S/C18H24O4/c1-11-4-9-14-17(16(11)19)22-15(10-18(14,2)20)12-5-7-13(21-3)8-6-12/h4-8,14-17,19-20H,9-10H2,1-3H3/t14-,15?,16-,17-,18?/m1/s1 |
| InChIKey | FHRQDQYEUHIJDR-DPKKHUKBSA-N |
| XLogP | 2.60 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|