About 5-chloro-N-phenyl-1H-pyrazolo[3,4-c]pyridin-7-amine
5-chloro-N-phenyl-1H-pyrazolo[3,4-c]pyridin-7-amine (PubChem CID 134151786) has the molecular formula C12H9ClN4
and a molecular weight of 244.69 g/mol. Its IUPAC name is 5-chloro-N-phenyl-1H-pyrazolo[3,4-c]pyridin-7-amine.
Molecular Properties
| Compound Name | 5-chloro-N-phenyl-1H-pyrazolo[3,4-c]pyridin-7-amine |
| PubChem CID | 134151786 |
| Molecular Formula | C12H9ClN4 |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 5-chloro-N-phenyl-1H-pyrazolo[3,4-c]pyridin-7-amine |
| SMILES | Clc1cc2cn[nH]c2c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C12H9ClN4/c13-10-6-8-7-14-17-11(8)12(16-10)15-9-4-2-1-3-5-9/h1-7H,(H,14,17)(H,15,16) |
| InChIKey | XREMNVJBFHCRDZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N-phenyl-1H-pyrazolo[3,4-c]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-phenyl-1H-pyrazolo[3,4-c]pyridin-7-amine?
The IUPAC name of 5-chloro-N-phenyl-1H-pyrazolo[3,4-c]pyridin-7-amine (CID 134151786) is 5-chloro-N-phenyl-1H-pyrazolo[3,4-c]pyridin-7-amine.
What is the SMILES notation for 5-chloro-N-phenyl-1H-pyrazolo[3,4-c]pyridin-7-amine?
The canonical SMILES for 5-chloro-N-phenyl-1H-pyrazolo[3,4-c]pyridin-7-amine is Clc1cc2cn[nH]c2c(Nc2ccccc2)n1.
What is the InChIKey of 5-chloro-N-phenyl-1H-pyrazolo[3,4-c]pyridin-7-amine?
The InChIKey is XREMNVJBFHCRDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClN4/c13-10-6-8-7-14-17-11(8)12(16-10)15-9-4-2-1-3-5-9/h1-7H,(H,14,17)(H,15,16).
What are the key properties of 5-chloro-N-phenyl-1H-pyrazolo[3,4-c]pyridin-7-amine?
5-chloro-N-phenyl-1H-pyrazolo[3,4-c]pyridin-7-amine has a molecular weight of 244.69 g/mol, XLogP of 3.35, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-phenyl-1H-pyrazolo[3,4-c]pyridin-7-amine is sourced from PubChem (CID 134151786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).