C18H22Br2O6 — CID 134151893
(1R,2S,7S,8R,9S,17S)-12-bromo-12-(bromomethyl)-7,8-dihydroxy-1,17-dimethyl-10,13-dioxatetracyclo[7.7.1.02,7.011,15]heptadec-11(15)-ene-14,16-dione (PubChem CID 134151893) has the molecular formula C18H22Br2O6 and a molecular weight of 494.18 g/mol. Its IUPAC name is (1R,2S,7S,8R,9S,17S)-12-bromo-12-(bromomethyl)-7,8-dihydroxy-1,17-dimethyl-10,13-dioxatetracyclo[7.7.1.02,7.011,15]heptadec-11(15)-ene-14,16-dione.
| Compound Name | (1R,2S,7S,8R,9S,17S)-12-bromo-12-(bromomethyl)-7,8-dihydroxy-1,17-dimethyl-10,13-dioxatetracyclo[7.7.1.02,7.011,15]heptadec-11(15)-ene-14,16-dione |
|---|---|
| PubChem CID | 134151893 |
| Molecular Formula | C18H22Br2O6 |
| Molecular Weight | 494.18 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | (1R,2S,7S,8R,9S,17S)-12-bromo-12-(bromomethyl)-7,8-dihydroxy-1,17-dimethyl-10,13-dioxatetracyclo[7.7.1.02,7.011,15]heptadec-11(15)-ene-14,16-dione |
| SMILES | C[C@@H]1[C@@H]2OC3=C(C(=O)OC3(Br)CBr)C(=O)[C@@]1(C)[C@@H]1CCCC[C@@]1(O)[C@@H]2O |
| InChI | InChI=1S/C18H22Br2O6/c1-8-11-13(22)17(24)6-4-3-5-9(17)16(8,2)12(21)10-14(25-11)18(20,7-19)26-15(10)23/h8-9,11,13,22,24H,3-7H2,1-2H3/t8-,9+,11+,13-,16-,17+,18?/m1/s1 |
| InChIKey | MTNQDVZANVJBAZ-KDADCSRZSA-N |
| XLogP | 2.19 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.18 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|