C22H24N4O3 — CID 134152228
ethyl 13-amino-3-[(4-methoxyphenyl)methyl]-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate (PubChem CID 134152228) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is ethyl 13-amino-3-[(4-methoxyphenyl)methyl]-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate.
| Compound Name | ethyl 13-amino-3-[(4-methoxyphenyl)methyl]-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 134152228 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | ethyl 13-amino-3-[(4-methoxyphenyl)methyl]-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate |
| SMILES | CCOC(=O)c1cc2c(n1Cc1ccc(OC)cc1)-c1nc(N)ncc1CCC2 |
| InChI | InChI=1S/C22H24N4O3/c1-3-29-21(27)18-11-15-5-4-6-16-12-24-22(23)25-19(16)20(15)26(18)13-14-7-9-17(28-2)10-8-14/h7-12H,3-6,13H2,1-2H3,(H2,23,24,25) |
| InChIKey | XUWSVEMVWHLIKJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |