C22H36O4 — CID 134152352
[(1S,3R,5S,8E,12S,13R)-5,9,13-trimethyl-1-propan-2-yl-4,16-dioxatricyclo[11.2.1.03,5]hexadec-8-en-12-yl] acetate (PubChem CID 134152352) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is [(1S,3R,5S,8E,12S,13R)-5,9,13-trimethyl-1-propan-2-yl-4,16-dioxatricyclo[11.2.1.03,5]hexadec-8-en-12-yl] acetate.
| Compound Name | [(1S,3R,5S,8E,12S,13R)-5,9,13-trimethyl-1-propan-2-yl-4,16-dioxatricyclo[11.2.1.03,5]hexadec-8-en-12-yl] acetate |
|---|---|
| PubChem CID | 134152352 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | [(1S,3R,5S,8E,12S,13R)-5,9,13-trimethyl-1-propan-2-yl-4,16-dioxatricyclo[11.2.1.03,5]hexadec-8-en-12-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC/C(C)=C/CC[C@]2(C)O[C@@H]2C[C@]2(C(C)C)CC[C@@]1(C)O2 |
| InChI | InChI=1S/C22H36O4/c1-15(2)22-13-12-21(6,26-22)18(24-17(4)23)10-9-16(3)8-7-11-20(5)19(14-22)25-20/h8,15,18-19H,7,9-14H2,1-6H3/b16-8+/t18-,19+,20-,21+,22-/m0/s1 |
| InChIKey | BYTWGKLYKQGCLX-GTUZTKPESA-N |
| XLogP | 4.95 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|