C22H23NO4 — CID 134152528
(1E,4Z,6E)-1,7-bis(4-hydroxyphenyl)-5-(3-hydroxypropylamino)hepta-1,4,6-trien-3-one (PubChem CID 134152528) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is (1E,4Z,6E)-1,7-bis(4-hydroxyphenyl)-5-(3-hydroxypropylamino)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-1,7-bis(4-hydroxyphenyl)-5-(3-hydroxypropylamino)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 134152528 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (1E,4Z,6E)-1,7-bis(4-hydroxyphenyl)-5-(3-hydroxypropylamino)hepta-1,4,6-trien-3-one |
| SMILES | O=C(/C=C(/C=C/c1ccc(O)cc1)NCCCO)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C22H23NO4/c24-15-1-14-23-19(8-2-17-3-9-20(25)10-4-17)16-22(27)13-7-18-5-11-21(26)12-6-18/h2-13,16,23-26H,1,14-15H2/b8-2+,13-7+,19-16- |
| InChIKey | KCRYKWIBRVOGQU-YSKVYPSDSA-N |
| XLogP | 3.25 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|