C33H40O4 — CID 134152692
(1S,3S,8R,10R)-6-benzoyl-9,9-dimethyl-8,10-bis(3-methylbut-2-enyl)-3-prop-1-en-2-yl-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione (PubChem CID 134152692) has the molecular formula C33H40O4 and a molecular weight of 500.68 g/mol. Its IUPAC name is (1S,3S,8R,10R)-6-benzoyl-9,9-dimethyl-8,10-bis(3-methylbut-2-enyl)-3-prop-1-en-2-yl-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione.
| Compound Name | (1S,3S,8R,10R)-6-benzoyl-9,9-dimethyl-8,10-bis(3-methylbut-2-enyl)-3-prop-1-en-2-yl-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
|---|---|
| PubChem CID | 134152692 |
| Molecular Formula | C33H40O4 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | (1S,3S,8R,10R)-6-benzoyl-9,9-dimethyl-8,10-bis(3-methylbut-2-enyl)-3-prop-1-en-2-yl-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
| SMILES | C=C(C)[C@@H]1C[C@@]23C[C@@H](CC=C(C)C)C(C)(C)[C@@](CC=C(C)C)(C(=O)C(C(=O)c4ccccc4)=C2O1)C3=O |
| InChI | InChI=1S/C33H40O4/c1-20(2)14-15-24-18-32-19-25(22(5)6)37-29(32)26(27(34)23-12-10-9-11-13-23)28(35)33(30(32)36,31(24,7)8)17-16-21(3)4/h9-14,16,24-25H,5,15,17-19H2,1-4,6-8H3/t24-,25+,32+,33+/m1/s1 |
| InChIKey | QMQZFXYNUWSRBT-MWGJFANYSA-N |
| XLogP | 7.37 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|