C20H21ClN8O2 — CID 134153039
N-[2-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)ethyl]-3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide (PubChem CID 134153039) has the molecular formula C20H21ClN8O2 and a molecular weight of 440.90 g/mol. Its IUPAC name is N-[2-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)ethyl]-3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide.
| Compound Name | N-[2-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)ethyl]-3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
|---|---|
| PubChem CID | 134153039 |
| Molecular Formula | C20H21ClN8O2 |
| Molecular Weight | 440.90 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-[2-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)ethyl]-3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| SMILES | CN1CCc2c(n(CCNC(=O)c3ncn4c(=O)n(C)nnc34)c3ccc(Cl)cc23)C1 |
| InChI | InChI=1S/C20H21ClN8O2/c1-26-7-5-13-14-9-12(21)3-4-15(14)28(16(13)10-26)8-6-22-19(30)17-18-24-25-27(2)20(31)29(18)11-23-17/h3-4,9,11H,5-8,10H2,1-2H3,(H,22,30) |
| InChIKey | WOTGLOZRLQAWPD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 102.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.90 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|