C22H22F3N5OS — CID 134153241
(3R,5S)-3,5-dimethyl-N-pyridin-3-yl-1-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide (PubChem CID 134153241) has the molecular formula C22H22F3N5OS and a molecular weight of 461.51 g/mol. Its IUPAC name is (3R,5S)-3,5-dimethyl-N-pyridin-3-yl-1-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide.
| Compound Name | (3R,5S)-3,5-dimethyl-N-pyridin-3-yl-1-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide |
|---|---|
| PubChem CID | 134153241 |
| Molecular Formula | C22H22F3N5OS |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | (3R,5S)-3,5-dimethyl-N-pyridin-3-yl-1-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide |
| SMILES | C[C@@H]1CN(Cc2cnc(C(F)(F)F)s2)c2ccccc2[C@H](C)N1C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C22H22F3N5OS/c1-14-12-29(13-17-11-27-20(32-17)22(23,24)25)19-8-4-3-7-18(19)15(2)30(14)21(31)28-16-6-5-9-26-10-16/h3-11,14-15H,12-13H2,1-2H3,(H,28,31)/t14-,15+/m1/s1 |
| InChIKey | GKWAPJKRLCMEES-CABCVRRESA-N |
| XLogP | 5.56 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |