About CID 134153301
CID 134153301 (PubChem CID 134153301) has the molecular formula C36H42O6
and a molecular weight of 570.73 g/mol.
Molecular Properties
| Compound Name | CID 134153301 |
| PubChem CID | 134153301 |
| Molecular Formula | C36H42O6 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | — |
| SMILES | CCC/C=C1\OC(=O)C2=C1CC[C@@H]1[C@@H]3CCC4=C(C(=O)OC45C(CCC)[C@@H](CCC)[C@@]54OC(=O)C5=C4CCC=C5)[C@@H]3[C@H]21 |
| InChI | InChI=1S/C36H42O6/c1-4-7-14-27-22-16-15-19-20-17-18-26-31(29(20)28(19)30(22)33(38)40-27)34(39)42-36(26)25(11-6-3)24(10-5-2)35(36)23-13-9-8-12-21(23)32(37)41-35/h8,12,14,19-20,24-25,28-29H,4-7,9-11,13,15-18H2,1-3H3/b27-14-/t19-,20+,24-,25?,28-,29+,35-,36?/m1/s1 |
| InChIKey | LCFSNWRFLLDWMT-ZBEGOGENSA-N |
| XLogP | 6.97 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze CID 134153301 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134153301?
The IUPAC name of CID 134153301 (CID 134153301) is not available.
What is the SMILES notation for CID 134153301?
The canonical SMILES for CID 134153301 is CCC/C=C1\OC(=O)C2=C1CC[C@@H]1[C@@H]3CCC4=C(C(=O)OC45C(CCC)[C@@H](CCC)[C@@]54OC(=O)C5=C4CCC=C5)[C@@H]3[C@H]21.
What is the InChIKey of CID 134153301?
The InChIKey is LCFSNWRFLLDWMT-ZBEGOGENSA-N. The full InChI is InChI=1S/C36H42O6/c1-4-7-14-27-22-16-15-19-20-17-18-26-31(29(20)28(19)30(22)33(38)40-27)34(39)42-36(26)25(11-6-3)24(10-5-2)35(36)23-13-9-8-12-21(23)32(37)41-35/h8,12,14,19-20,24-25,28-29H,4-7,9-11,13,15-18H2,1-3H3/b27-14-/t19-,20+,24-,25?,28-,29+,35-,36?/m1/s1.
What are the key properties of CID 134153301?
CID 134153301 has a molecular weight of 570.73 g/mol, XLogP of 6.97, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134153301 is sourced from PubChem (CID 134153301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).