C29H32N2O2 — CID 134153425
(3S,4'R,6'R)-1-benzyl-4'-(benzylamino)-6'-propylspiro[indole-3,2'-oxane]-2-one (PubChem CID 134153425) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is (3S,4'R,6'R)-1-benzyl-4'-(benzylamino)-6'-propylspiro[indole-3,2'-oxane]-2-one.
| Compound Name | (3S,4'R,6'R)-1-benzyl-4'-(benzylamino)-6'-propylspiro[indole-3,2'-oxane]-2-one |
|---|---|
| PubChem CID | 134153425 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | (3S,4'R,6'R)-1-benzyl-4'-(benzylamino)-6'-propylspiro[indole-3,2'-oxane]-2-one |
| SMILES | CCC[C@@H]1C[C@@H](NCc2ccccc2)C[C@@]2(O1)C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C29H32N2O2/c1-2-11-25-18-24(30-20-22-12-5-3-6-13-22)19-29(33-25)26-16-9-10-17-27(26)31(28(29)32)21-23-14-7-4-8-15-23/h3-10,12-17,24-25,30H,2,11,18-21H2,1H3/t24-,25-,29+/m1/s1 |
| InChIKey | SNUNOEILOVKZKM-MIHVYDCKSA-N |
| XLogP | 5.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |