C27H37NO3 — CID 134153621
(1S,2E,4E,6R,9R,11R,12E,14E,16R,19R,20S)-9-[(E)-hex-2-enyl]-19,20-dihydroxy-2,14-dimethyl-8-azatricyclo[14.4.0.06,11]icosa-2,4,12,14,17-pentaen-7-one (PubChem CID 134153621) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is (1S,2E,4E,6R,9R,11R,12E,14E,16R,19R,20S)-9-[(E)-hex-2-enyl]-19,20-dihydroxy-2,14-dimethyl-8-azatricyclo[14.4.0.06,11]icosa-2,4,12,14,17-pentaen-7-one.
| Compound Name | (1S,2E,4E,6R,9R,11R,12E,14E,16R,19R,20S)-9-[(E)-hex-2-enyl]-19,20-dihydroxy-2,14-dimethyl-8-azatricyclo[14.4.0.06,11]icosa-2,4,12,14,17-pentaen-7-one |
|---|---|
| PubChem CID | 134153621 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | (1S,2E,4E,6R,9R,11R,12E,14E,16R,19R,20S)-9-[(E)-hex-2-enyl]-19,20-dihydroxy-2,14-dimethyl-8-azatricyclo[14.4.0.06,11]icosa-2,4,12,14,17-pentaen-7-one |
| SMILES | CCC/C=C/C[C@@H]1C[C@@H]2/C=C/C(C)=C/[C@H]3C=C[C@@H](O)[C@@H](O)[C@@H]3/C(C)=C/C=C/[C@H]2C(=O)N1 |
| InChI | InChI=1S/C27H37NO3/c1-4-5-6-7-10-22-17-20-13-12-18(2)16-21-14-15-24(29)26(30)25(21)19(3)9-8-11-23(20)27(31)28-22/h6-9,11-16,20-26,29-30H,4-5,10,17H2,1-3H3,(H,28,31)/b7-6+,11-8+,13-12+,18-16+,19-9+/t20-,21+,22+,23+,24+,25+,26+/m0/s1 |
| InChIKey | FNHBTFMUTRPDSA-CAZALVFNSA-N |
| XLogP | 4.40 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|