C22H33N7O8 — CID 134153666
(2R,3R,4S)-3-acetamido-4-[[amino-[[2-(4-cyclohexyltriazol-1-yl)acetyl]amino]methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 134153666) has the molecular formula C22H33N7O8 and a molecular weight of 523.55 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-[[amino-[[2-(4-cyclohexyltriazol-1-yl)acetyl]amino]methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-[[amino-[[2-(4-cyclohexyltriazol-1-yl)acetyl]amino]methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 134153666 |
| Molecular Formula | C22H33N7O8 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-[[amino-[[2-(4-cyclohexyltriazol-1-yl)acetyl]amino]methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)O)=C[C@@H]1/N=C(\N)NC(=O)Cn1cc(C2CCCCC2)nn1 |
| InChI | InChI=1S/C22H33N7O8/c1-11(31)24-18-13(7-16(21(35)36)37-20(18)19(34)15(32)10-30)25-22(23)26-17(33)9-29-8-14(27-28-29)12-5-3-2-4-6-12/h7-8,12-13,15,18-20,30,32,34H,2-6,9-10H2,1H3,(H,24,31)(H,35,36)(H3,23,25,26,33)/t13-,15+,18+,19+,20+/m0/s1 |
| InChIKey | IRZBJEGSUGPZIK-CWYSQHEVSA-N |
| XLogP | -2.29 |
| TPSA | 234.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|