C32H50O3 — CID 134154131
methyl (2R,6R)-2-methyl-3-methylidene-6-[(1S,3R,8R,11S,12S,15R,16R)-7,7,12,16-tetramethyl-6-oxo-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]heptanoate (PubChem CID 134154131) has the molecular formula C32H50O3 and a molecular weight of 482.75 g/mol. Its IUPAC name is methyl (2R,6R)-2-methyl-3-methylidene-6-[(1S,3R,8R,11S,12S,15R,16R)-7,7,12,16-tetramethyl-6-oxo-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]heptanoate.
| Compound Name | methyl (2R,6R)-2-methyl-3-methylidene-6-[(1S,3R,8R,11S,12S,15R,16R)-7,7,12,16-tetramethyl-6-oxo-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]heptanoate |
|---|---|
| PubChem CID | 134154131 |
| Molecular Formula | C32H50O3 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.38 |
| IUPAC Name | methyl (2R,6R)-2-methyl-3-methylidene-6-[(1S,3R,8R,11S,12S,15R,16R)-7,7,12,16-tetramethyl-6-oxo-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]heptanoate |
| SMILES | C=C(CC[C@@H](C)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)C(=O)CC[C@@]45C[C@@]35CC[C@]12C)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C32H50O3/c1-20(22(3)27(34)35-8)9-10-21(2)23-13-15-30(7)25-12-11-24-28(4,5)26(33)14-16-31(24)19-32(25,31)18-17-29(23,30)6/h21-25H,1,9-19H2,2-8H3/t21-,22-,23-,24+,25+,29-,30+,31-,32+/m1/s1 |
| InChIKey | GZLGLDJWZDRXCP-UATFPWQZSA-N |
| XLogP | 7.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|