C15H24BrClO — CID 134154583
(3R,6R,9S,10R)-9-bromo-10-chloro-1,5,5,9-tetramethylspiro[5.5]undec-1-en-3-ol (PubChem CID 134154583) has the molecular formula C15H24BrClO and a molecular weight of 335.71 g/mol. Its IUPAC name is (3R,6R,9S,10R)-9-bromo-10-chloro-1,5,5,9-tetramethylspiro[5.5]undec-1-en-3-ol.
| Compound Name | (3R,6R,9S,10R)-9-bromo-10-chloro-1,5,5,9-tetramethylspiro[5.5]undec-1-en-3-ol |
|---|---|
| PubChem CID | 134154583 |
| Molecular Formula | C15H24BrClO |
| Molecular Weight | 335.71 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (3R,6R,9S,10R)-9-bromo-10-chloro-1,5,5,9-tetramethylspiro[5.5]undec-1-en-3-ol |
| SMILES | CC1=C[C@H](O)CC(C)(C)[C@]12CC[C@](C)(Br)[C@H](Cl)C2 |
| InChI | InChI=1S/C15H24BrClO/c1-10-7-11(18)8-13(2,3)15(10)6-5-14(4,16)12(17)9-15/h7,11-12,18H,5-6,8-9H2,1-4H3/t11-,12+,14-,15-/m0/s1 |
| InChIKey | CWIWNYOZGCYDSH-NEBZKDRISA-N |
| XLogP | 4.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.71 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|