About 7-methoxyphenanthrene-2,4,5-triol
7-methoxyphenanthrene-2,4,5-triol (PubChem CID 134154603) has the molecular formula C15H12O4
and a molecular weight of 256.26 g/mol. Its IUPAC name is 7-methoxyphenanthrene-2,4,5-triol.
Molecular Properties
| Compound Name | 7-methoxyphenanthrene-2,4,5-triol |
| PubChem CID | 134154603 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 7-methoxyphenanthrene-2,4,5-triol |
| SMILES | COc1cc(O)c2c(ccc3cc(O)cc(O)c32)c1 |
| InChI | InChI=1S/C15H12O4/c1-19-11-5-9-3-2-8-4-10(16)6-12(17)14(8)15(9)13(18)7-11/h2-7,16-18H,1H3 |
| InChIKey | IQNTVFCKFSVGEO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxyphenanthrene-2,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxyphenanthrene-2,4,5-triol?
The IUPAC name of 7-methoxyphenanthrene-2,4,5-triol (CID 134154603) is 7-methoxyphenanthrene-2,4,5-triol.
What is the SMILES notation for 7-methoxyphenanthrene-2,4,5-triol?
The canonical SMILES for 7-methoxyphenanthrene-2,4,5-triol is COc1cc(O)c2c(ccc3cc(O)cc(O)c32)c1.
What is the InChIKey of 7-methoxyphenanthrene-2,4,5-triol?
The InChIKey is IQNTVFCKFSVGEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O4/c1-19-11-5-9-3-2-8-4-10(16)6-12(17)14(8)15(9)13(18)7-11/h2-7,16-18H,1H3.
What are the key properties of 7-methoxyphenanthrene-2,4,5-triol?
7-methoxyphenanthrene-2,4,5-triol has a molecular weight of 256.26 g/mol, XLogP of 3.12, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxyphenanthrene-2,4,5-triol is sourced from PubChem (CID 134154603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).