C31H32O7 — CID 134154747
(1E,4E)-1-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-5-(2,4,6-trimethoxyphenyl)penta-1,4-dien-3-one (PubChem CID 134154747) has the molecular formula C31H32O7 and a molecular weight of 516.59 g/mol. Its IUPAC name is (1E,4E)-1-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-5-(2,4,6-trimethoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-5-(2,4,6-trimethoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 134154747 |
| Molecular Formula | C31H32O7 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | (1E,4E)-1-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-5-(2,4,6-trimethoxyphenyl)penta-1,4-dien-3-one |
| SMILES | COc1ccc(/C=C/c2cc(OC)cc(OC)c2/C=C/C(=O)/C=C/c2c(OC)cc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C31H32O7/c1-33-24-13-8-21(9-14-24)7-10-22-17-25(34-2)18-29(36-4)27(22)15-11-23(32)12-16-28-30(37-5)19-26(35-3)20-31(28)38-6/h7-20H,1-6H3/b10-7+,15-11+,16-12+ |
| InChIKey | DSOVFYQVBKPNBF-NSISIHQKSA-N |
| XLogP | 6.20 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|