C21H20ClF2N5O2S — CID 134154935
5-chloro-2-N-[(E)-1-(2,4-difluorophenyl)ethylideneamino]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine (PubChem CID 134154935) has the molecular formula C21H20ClF2N5O2S and a molecular weight of 479.94 g/mol. Its IUPAC name is 5-chloro-2-N-[(E)-1-(2,4-difluorophenyl)ethylideneamino]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-[(E)-1-(2,4-difluorophenyl)ethylideneamino]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134154935 |
| Molecular Formula | C21H20ClF2N5O2S |
| Molecular Weight | 479.94 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 5-chloro-2-N-[(E)-1-(2,4-difluorophenyl)ethylideneamino]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine |
| SMILES | C/C(=N\Nc1ncc(Cl)c(Nc2ccccc2S(=O)(=O)C(C)C)n1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H20ClF2N5O2S/c1-12(2)32(30,31)19-7-5-4-6-18(19)26-20-16(22)11-25-21(27-20)29-28-13(3)15-9-8-14(23)10-17(15)24/h4-12H,1-3H3,(H2,25,26,27,29)/b28-13+ |
| InChIKey | GKQMBGIFEGSUEB-XODNFHPESA-N |
| XLogP | 5.17 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.94 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|