C17H15ClN4O4S2 — CID 134154940
5-chloro-N-[2-[[4-(2-oxopyrazin-1-yl)phenyl]sulfamoyl]ethyl]thiophene-2-carboxamide (PubChem CID 134154940) has the molecular formula C17H15ClN4O4S2 and a molecular weight of 438.92 g/mol. Its IUPAC name is 5-chloro-N-[2-[[4-(2-oxopyrazin-1-yl)phenyl]sulfamoyl]ethyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[2-[[4-(2-oxopyrazin-1-yl)phenyl]sulfamoyl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 134154940 |
| Molecular Formula | C17H15ClN4O4S2 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 5-chloro-N-[2-[[4-(2-oxopyrazin-1-yl)phenyl]sulfamoyl]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCS(=O)(=O)Nc1ccc(-n2ccncc2=O)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H15ClN4O4S2/c18-15-6-5-14(27-15)17(24)20-8-10-28(25,26)21-12-1-3-13(4-2-12)22-9-7-19-11-16(22)23/h1-7,9,11,21H,8,10H2,(H,20,24) |
| InChIKey | YSWODTNWYVODPG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |