About propan-2-yl 4-pyrimidin-4-yl-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxylate
propan-2-yl 4-pyrimidin-4-yl-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxylate (PubChem CID 134155117) has the molecular formula C15H14N6O2S
and a molecular weight of 342.38 g/mol. Its IUPAC name is propan-2-yl 4-pyrimidin-4-yl-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 4-pyrimidin-4-yl-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxylate |
| PubChem CID | 134155117 |
| Molecular Formula | C15H14N6O2S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | propan-2-yl 4-pyrimidin-4-yl-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxylate |
| SMILES | CC(C)OC(=O)c1sc(Nc2ncccn2)nc1-c1ccncn1 |
| InChI | InChI=1S/C15H14N6O2S/c1-9(2)23-13(22)12-11(10-4-7-16-8-19-10)20-15(24-12)21-14-17-5-3-6-18-14/h3-9H,1-2H3,(H,17,18,20,21) |
| InChIKey | QGLMSJCIXSYWLS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze propan-2-yl 4-pyrimidin-4-yl-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-pyrimidin-4-yl-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxylate?
The IUPAC name of propan-2-yl 4-pyrimidin-4-yl-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxylate (CID 134155117) is propan-2-yl 4-pyrimidin-4-yl-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxylate.
What is the SMILES notation for propan-2-yl 4-pyrimidin-4-yl-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxylate?
The canonical SMILES for propan-2-yl 4-pyrimidin-4-yl-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxylate is CC(C)OC(=O)c1sc(Nc2ncccn2)nc1-c1ccncn1.
What is the InChIKey of propan-2-yl 4-pyrimidin-4-yl-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxylate?
The InChIKey is QGLMSJCIXSYWLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N6O2S/c1-9(2)23-13(22)12-11(10-4-7-16-8-19-10)20-15(24-12)21-14-17-5-3-6-18-14/h3-9H,1-2H3,(H,17,18,20,21).
What are the key properties of propan-2-yl 4-pyrimidin-4-yl-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxylate?
propan-2-yl 4-pyrimidin-4-yl-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxylate has a molecular weight of 342.38 g/mol, XLogP of 2.70, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-pyrimidin-4-yl-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 134155117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).