About 5-fluoro-1-hydroxyindole
5-fluoro-1-hydroxyindole (PubChem CID 13415513) has the molecular formula C8H6FNO
and a molecular weight of 151.14 g/mol. Its IUPAC name is 5-fluoro-1-hydroxyindole.
Molecular Properties
| Compound Name | 5-fluoro-1-hydroxyindole |
| PubChem CID | 13415513 |
| Molecular Formula | C8H6FNO |
| Molecular Weight | 151.14 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 5-fluoro-1-hydroxyindole |
| SMILES | On1ccc2cc(F)ccc21 |
| InChI | InChI=1S/C8H6FNO/c9-7-1-2-8-6(5-7)3-4-10(8)11/h1-5,11H |
| InChIKey | ZIIMOKUHFYBIRY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.14 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-1-hydroxyindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1-hydroxyindole?
The IUPAC name of 5-fluoro-1-hydroxyindole (CID 13415513) is 5-fluoro-1-hydroxyindole.
What is the SMILES notation for 5-fluoro-1-hydroxyindole?
The canonical SMILES for 5-fluoro-1-hydroxyindole is On1ccc2cc(F)ccc21.
What is the InChIKey of 5-fluoro-1-hydroxyindole?
The InChIKey is ZIIMOKUHFYBIRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FNO/c9-7-1-2-8-6(5-7)3-4-10(8)11/h1-5,11H.
What are the key properties of 5-fluoro-1-hydroxyindole?
5-fluoro-1-hydroxyindole has a molecular weight of 151.14 g/mol, XLogP of 2.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1-hydroxyindole is sourced from PubChem (CID 13415513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).