C26H30ClN3O — CID 134155149
N-(1-benzylpiperidin-4-yl)-6-chloro-4-(2,4,6-trimethylphenoxy)pyridin-2-amine (PubChem CID 134155149) has the molecular formula C26H30ClN3O and a molecular weight of 436.00 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-6-chloro-4-(2,4,6-trimethylphenoxy)pyridin-2-amine.
| Compound Name | N-(1-benzylpiperidin-4-yl)-6-chloro-4-(2,4,6-trimethylphenoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 134155149 |
| Molecular Formula | C26H30ClN3O |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-6-chloro-4-(2,4,6-trimethylphenoxy)pyridin-2-amine |
| SMILES | Cc1cc(C)c(Oc2cc(Cl)nc(NC3CCN(Cc4ccccc4)CC3)c2)c(C)c1 |
| InChI | InChI=1S/C26H30ClN3O/c1-18-13-19(2)26(20(3)14-18)31-23-15-24(27)29-25(16-23)28-22-9-11-30(12-10-22)17-21-7-5-4-6-8-21/h4-8,13-16,22H,9-12,17H2,1-3H3,(H,28,29) |
| InChIKey | QIOCZHLRPGEWSZ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|