C15H20O4 — CID 134155373
(1S,4S,7S,9R,10Z,13R)-9-hydroxy-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]tridec-10-ene-2,8-dione (PubChem CID 134155373) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1S,4S,7S,9R,10Z,13R)-9-hydroxy-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]tridec-10-ene-2,8-dione.
| Compound Name | (1S,4S,7S,9R,10Z,13R)-9-hydroxy-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]tridec-10-ene-2,8-dione |
|---|---|
| PubChem CID | 134155373 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (1S,4S,7S,9R,10Z,13R)-9-hydroxy-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]tridec-10-ene-2,8-dione |
| SMILES | CC1(C)C[C@@H]2C(=O)[C@](C)(O)/C=C\C[C@@H]3C(=O)O[C@H]1[C@@H]32 |
| InChI | InChI=1S/C15H20O4/c1-14(2)7-9-10-8(13(17)19-12(10)14)5-4-6-15(3,18)11(9)16/h4,6,8-10,12,18H,5,7H2,1-3H3/b6-4-/t8-,9-,10-,12-,15+/m0/s1 |
| InChIKey | SSLFVMZIHSFCFN-DPLXHKJPSA-N |
| XLogP | 1.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|