About 2-N,5-N-bis[(4-ethoxyphenyl)methyl]pyridine-2,5-diamine
2-N,5-N-bis[(4-ethoxyphenyl)methyl]pyridine-2,5-diamine (PubChem CID 134155421) has the molecular formula C23H27N3O2
and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-N,5-N-bis[(4-ethoxyphenyl)methyl]pyridine-2,5-diamine.
Molecular Properties
| Compound Name | 2-N,5-N-bis[(4-ethoxyphenyl)methyl]pyridine-2,5-diamine |
| PubChem CID | 134155421 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-N,5-N-bis[(4-ethoxyphenyl)methyl]pyridine-2,5-diamine |
| SMILES | CCOc1ccc(CNc2ccc(NCc3ccc(OCC)cc3)nc2)cc1 |
| InChI | InChI=1S/C23H27N3O2/c1-3-27-21-10-5-18(6-11-21)15-24-20-9-14-23(26-17-20)25-16-19-7-12-22(13-8-19)28-4-2/h5-14,17,24H,3-4,15-16H2,1-2H3,(H,25,26) |
| InChIKey | YGODEESPLSKPHM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N,5-N-bis[(4-ethoxyphenyl)methyl]pyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,5-N-bis[(4-ethoxyphenyl)methyl]pyridine-2,5-diamine?
The IUPAC name of 2-N,5-N-bis[(4-ethoxyphenyl)methyl]pyridine-2,5-diamine (CID 134155421) is 2-N,5-N-bis[(4-ethoxyphenyl)methyl]pyridine-2,5-diamine.
What is the SMILES notation for 2-N,5-N-bis[(4-ethoxyphenyl)methyl]pyridine-2,5-diamine?
The canonical SMILES for 2-N,5-N-bis[(4-ethoxyphenyl)methyl]pyridine-2,5-diamine is CCOc1ccc(CNc2ccc(NCc3ccc(OCC)cc3)nc2)cc1.
What is the InChIKey of 2-N,5-N-bis[(4-ethoxyphenyl)methyl]pyridine-2,5-diamine?
The InChIKey is YGODEESPLSKPHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O2/c1-3-27-21-10-5-18(6-11-21)15-24-20-9-14-23(26-17-20)25-16-19-7-12-22(13-8-19)28-4-2/h5-14,17,24H,3-4,15-16H2,1-2H3,(H,25,26).
What are the key properties of 2-N,5-N-bis[(4-ethoxyphenyl)methyl]pyridine-2,5-diamine?
2-N,5-N-bis[(4-ethoxyphenyl)methyl]pyridine-2,5-diamine has a molecular weight of 377.49 g/mol, XLogP of 5.10, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,5-N-bis[(4-ethoxyphenyl)methyl]pyridine-2,5-diamine is sourced from PubChem (CID 134155421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).