About 3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-1-amine
3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-1-amine (PubChem CID 134155463) has the molecular formula C16H28N3+
and a molecular weight of 262.42 g/mol. Its IUPAC name is 3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-1-amine.
Molecular Properties
| Compound Name | 3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-1-amine |
| PubChem CID | 134155463 |
| Molecular Formula | C16H28N3+ |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-1-amine |
| SMILES | CCCCCCCCCc1cc2[n+](c(N)n1)CCC2 |
| InChI | InChI=1S/C16H27N3/c1-2-3-4-5-6-7-8-10-14-13-15-11-9-12-19(15)16(17)18-14/h13,17H,2-12H2,1H3/p+1 |
| InChIKey | OWEHMVZHDWOFAG-UHFFFAOYSA-O |
| XLogP | 3.19 |
| TPSA | 42.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-1-amine?
The IUPAC name of 3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-1-amine (CID 134155463) is 3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-1-amine.
What is the SMILES notation for 3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-1-amine?
The canonical SMILES for 3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-1-amine is CCCCCCCCCc1cc2[n+](c(N)n1)CCC2.
What is the InChIKey of 3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-1-amine?
The InChIKey is OWEHMVZHDWOFAG-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H27N3/c1-2-3-4-5-6-7-8-10-14-13-15-11-9-12-19(15)16(17)18-14/h13,17H,2-12H2,1H3/p+1.
What are the key properties of 3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-1-amine?
3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-1-amine has a molecular weight of 262.42 g/mol, XLogP of 3.19, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nonyl-6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidin-8-ium-1-amine is sourced from PubChem (CID 134155463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).