C21H26FN3O6 — CID 134155521
tert-butyl N-[3-(4-fluorophenyl)-1-oxo-1-[2-[(2,3,4-trihydroxyphenyl)methyl]hydrazinyl]propan-2-yl]carbamate (PubChem CID 134155521) has the molecular formula C21H26FN3O6 and a molecular weight of 435.45 g/mol. Its IUPAC name is tert-butyl N-[3-(4-fluorophenyl)-1-oxo-1-[2-[(2,3,4-trihydroxyphenyl)methyl]hydrazinyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-(4-fluorophenyl)-1-oxo-1-[2-[(2,3,4-trihydroxyphenyl)methyl]hydrazinyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 134155521 |
| Molecular Formula | C21H26FN3O6 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | tert-butyl N-[3-(4-fluorophenyl)-1-oxo-1-[2-[(2,3,4-trihydroxyphenyl)methyl]hydrazinyl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(F)cc1)C(=O)NNCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C21H26FN3O6/c1-21(2,3)31-20(30)24-15(10-12-4-7-14(22)8-5-12)19(29)25-23-11-13-6-9-16(26)18(28)17(13)27/h4-9,15,23,26-28H,10-11H2,1-3H3,(H,24,30)(H,25,29) |
| InChIKey | HNMQUFLWIXDGTB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|