About [4-[3-(butylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3,4-dihydroxybenzoate
[4-[3-(butylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3,4-dihydroxybenzoate (PubChem CID 134155526) has the molecular formula C27H25NO6
and a molecular weight of 459.50 g/mol. Its IUPAC name is [4-[3-(butylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3,4-dihydroxybenzoate.
Molecular Properties
| Compound Name | [4-[3-(butylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3,4-dihydroxybenzoate |
| PubChem CID | 134155526 |
| Molecular Formula | C27H25NO6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | [4-[3-(butylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3,4-dihydroxybenzoate |
| SMILES | CCCCNC(=O)c1c(-c2ccc(COC(=O)c3ccc(O)c(O)c3)cc2)oc2ccccc12 |
| InChI | InChI=1S/C27H25NO6/c1-2-3-14-28-26(31)24-20-6-4-5-7-23(20)34-25(24)18-10-8-17(9-11-18)16-33-27(32)19-12-13-21(29)22(30)15-19/h4-13,15,29-30H,2-3,14,16H2,1H3,(H,28,31) |
| InChIKey | MYCXCNCGEOJQIZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-(butylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3,4-dihydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(butylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3,4-dihydroxybenzoate?
The IUPAC name of [4-[3-(butylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3,4-dihydroxybenzoate (CID 134155526) is [4-[3-(butylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3,4-dihydroxybenzoate.
What is the SMILES notation for [4-[3-(butylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3,4-dihydroxybenzoate?
The canonical SMILES for [4-[3-(butylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3,4-dihydroxybenzoate is CCCCNC(=O)c1c(-c2ccc(COC(=O)c3ccc(O)c(O)c3)cc2)oc2ccccc12.
What is the InChIKey of [4-[3-(butylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3,4-dihydroxybenzoate?
The InChIKey is MYCXCNCGEOJQIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25NO6/c1-2-3-14-28-26(31)24-20-6-4-5-7-23(20)34-25(24)18-10-8-17(9-11-18)16-33-27(32)19-12-13-21(29)22(30)15-19/h4-13,15,29-30H,2-3,14,16H2,1H3,(H,28,31).
What are the key properties of [4-[3-(butylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3,4-dihydroxybenzoate?
[4-[3-(butylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3,4-dihydroxybenzoate has a molecular weight of 459.50 g/mol, XLogP of 5.40, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(butylcarbamoyl)-1-benzofuran-2-yl]phenyl]methyl 3,4-dihydroxybenzoate is sourced from PubChem (CID 134155526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).