C27H31N3O4 — CID 134155987
(1-benzyltriazol-4-yl)methyl (2R)-2-[(2R)-7-acetyloxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanoate (PubChem CID 134155987) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is (1-benzyltriazol-4-yl)methyl (2R)-2-[(2R)-7-acetyloxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanoate.
| Compound Name | (1-benzyltriazol-4-yl)methyl (2R)-2-[(2R)-7-acetyloxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 134155987 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | (1-benzyltriazol-4-yl)methyl (2R)-2-[(2R)-7-acetyloxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanoate |
| SMILES | CC(=O)Oc1cc(C)c2c(c1C)C[C@H]([C@@H](C)C(=O)OCc1cn(Cc3ccccc3)nn1)CC2 |
| InChI | InChI=1S/C27H31N3O4/c1-17-12-26(34-20(4)31)19(3)25-13-22(10-11-24(17)25)18(2)27(32)33-16-23-15-30(29-28-23)14-21-8-6-5-7-9-21/h5-9,12,15,18,22H,10-11,13-14,16H2,1-4H3/t18-,22-/m1/s1 |
| InChIKey | YZBZUUWMGPARDH-XMSQKQJNSA-N |
| XLogP | 4.35 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|