C20H2Cl4I4Na2O5 — CID 134156299
disodium;2,3,4,5-tetrachloro-6-(2,7-di(125I)iodo-4,5-diiodo-3-oxido-6-oxoxanthen-9-yl)(125I2)benzoate (PubChem CID 134156299) has the molecular formula C20H2Cl4I4Na2O5 and a molecular weight of 1013.64 g/mol. Its IUPAC name is disodium;2,3,4,5-tetrachloro-6-(2,7-di(125I)iodo-4,5-diiodo-3-oxido-6-oxoxanthen-9-yl)(125I2)benzoate.
| Compound Name | disodium;2,3,4,5-tetrachloro-6-(2,7-di(125I)iodo-4,5-diiodo-3-oxido-6-oxoxanthen-9-yl)(125I2)benzoate |
|---|---|
| PubChem CID | 134156299 |
| Molecular Formula | C20H2Cl4I4Na2O5 |
| Molecular Weight | 1013.64 g/mol |
| Exact Mass | 1011.46 |
| IUPAC Name | disodium;2,3,4,5-tetrachloro-6-(2,7-di(125I)iodo-4,5-diiodo-3-oxido-6-oxoxanthen-9-yl)(125I2)benzoate |
| SMILES | O=C([O-])c1c(Cl)c(Cl)c(Cl)c(Cl)c1-c1c2cc([125I])c(=O)c(I)c-2oc2c(I)c([O-])c([125I])cc12.[Na+].[Na+] |
| InChI | InChI=1S/C20H4Cl4I4O5.2Na/c21-10-8(9(20(31)32)11(22)13(24)12(10)23)7-3-1-5(25)16(29)14(27)18(3)33-19-4(7)2-6(26)17(30)15(19)28;;/h1-2,29H,(H,31,32);;/q;2*+1/p-2/i25-2,26-2;; |
| InChIKey | UWBXIFCTIZXXLS-GNOWZSGOSA-L |
| XLogP | 1.04 |
| TPSA | 93.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.64 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|