C17H18N6S — CID 134156491
2-methyl-N-[(E)-1-pyrazin-2-ylethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 134156491) has the molecular formula C17H18N6S and a molecular weight of 338.44 g/mol. Its IUPAC name is 2-methyl-N-[(E)-1-pyrazin-2-ylethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-methyl-N-[(E)-1-pyrazin-2-ylethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 134156491 |
| Molecular Formula | C17H18N6S |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-methyl-N-[(E)-1-pyrazin-2-ylethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | C/C(=N\Nc1nc(C)nc2sc3c(c12)CCCC3)c1cnccn1 |
| InChI | InChI=1S/C17H18N6S/c1-10(13-9-18-7-8-19-13)22-23-16-15-12-5-3-4-6-14(12)24-17(15)21-11(2)20-16/h7-9H,3-6H2,1-2H3,(H,20,21,23)/b22-10+ |
| InChIKey | IIAOGLNJKRNMSO-LSHDLFTRSA-N |
| XLogP | 3.50 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|