C25H27ClN4O4 — CID 134156515
[1-(2-chloro-3-pyridinyl)triazol-4-yl]methyl (2R)-2-[(2R)-7-acetyloxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanoate (PubChem CID 134156515) has the molecular formula C25H27ClN4O4 and a molecular weight of 482.97 g/mol. Its IUPAC name is [1-(2-chloro-3-pyridinyl)triazol-4-yl]methyl (2R)-2-[(2R)-7-acetyloxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanoate.
| Compound Name | [1-(2-chloro-3-pyridinyl)triazol-4-yl]methyl (2R)-2-[(2R)-7-acetyloxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 134156515 |
| Molecular Formula | C25H27ClN4O4 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | [1-(2-chloro-3-pyridinyl)triazol-4-yl]methyl (2R)-2-[(2R)-7-acetyloxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanoate |
| SMILES | CC(=O)Oc1cc(C)c2c(c1C)C[C@H]([C@@H](C)C(=O)OCc1cn(-c3cccnc3Cl)nn1)CC2 |
| InChI | InChI=1S/C25H27ClN4O4/c1-14-10-23(34-17(4)31)16(3)21-11-18(7-8-20(14)21)15(2)25(32)33-13-19-12-30(29-28-19)22-6-5-9-27-24(22)26/h5-6,9-10,12,15,18H,7-8,11,13H2,1-4H3/t15-,18-/m1/s1 |
| InChIKey | ONQASBMYPIHBKJ-CRAIPNDOSA-N |
| XLogP | 4.34 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|