C23H23F3N6O2S2 — CID 134156601
[6-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]-3-pyridinyl]-[(1R,5S)-3-(2,2,2-trifluoroethoxyimino)-8-azabicyclo[3.2.1]octan-8-yl]methanone (PubChem CID 134156601) has the molecular formula C23H23F3N6O2S2 and a molecular weight of 536.61 g/mol. Its IUPAC name is [6-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]-3-pyridinyl]-[(1R,5S)-3-(2,2,2-trifluoroethoxyimino)-8-azabicyclo[3.2.1]octan-8-yl]methanone.
| Compound Name | [6-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]-3-pyridinyl]-[(1R,5S)-3-(2,2,2-trifluoroethoxyimino)-8-azabicyclo[3.2.1]octan-8-yl]methanone |
|---|---|
| PubChem CID | 134156601 |
| Molecular Formula | C23H23F3N6O2S2 |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | [6-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]-3-pyridinyl]-[(1R,5S)-3-(2,2,2-trifluoroethoxyimino)-8-azabicyclo[3.2.1]octan-8-yl]methanone |
| SMILES | Cc1nc(C)c(-c2csc(Nc3ccc(C(=O)N4[C@@H]5CC[C@H]4C/C(=N/OCC(F)(F)F)C5)cn3)n2)s1 |
| InChI | InChI=1S/C23H23F3N6O2S2/c1-12-20(36-13(2)28-12)18-10-35-22(29-18)30-19-6-3-14(9-27-19)21(33)32-16-4-5-17(32)8-15(7-16)31-34-11-23(24,25)26/h3,6,9-10,16-17H,4-5,7-8,11H2,1-2H3,(H,27,29,30)/b31-15-/t16-,17+/m0/s1 |
| InChIKey | HRPZHVMUTDQPOZ-LPMRMCHTSA-N |
| XLogP | 5.72 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|