C25H25N5O3 — CID 134156630
1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-(3,4-dimethylphenyl)urea (PubChem CID 134156630) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is 1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-(3,4-dimethylphenyl)urea.
| Compound Name | 1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-(3,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 134156630 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-(3,4-dimethylphenyl)urea |
| SMILES | COc1cc(Nc2ncnc3c(NC(=O)Nc4ccc(C)c(C)c4)cccc23)cc(OC)c1 |
| InChI | InChI=1S/C25H25N5O3/c1-15-8-9-17(10-16(15)2)29-25(31)30-22-7-5-6-21-23(22)26-14-27-24(21)28-18-11-19(32-3)13-20(12-18)33-4/h5-14H,1-4H3,(H,26,27,28)(H2,29,30,31) |
| InChIKey | SVUVYOATPPLHGS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |