About 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(thiophen-3-ylmethyl)propanamide
3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(thiophen-3-ylmethyl)propanamide (PubChem CID 134156757) has the molecular formula C21H20N4OS
and a molecular weight of 376.49 g/mol. Its IUPAC name is 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(thiophen-3-ylmethyl)propanamide.
Molecular Properties
| Compound Name | 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(thiophen-3-ylmethyl)propanamide |
| PubChem CID | 134156757 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(thiophen-3-ylmethyl)propanamide |
| SMILES | O=C(CCc1nc2cccnc2n1Cc1ccccc1)NCc1ccsc1 |
| InChI | InChI=1S/C21H20N4OS/c26-20(23-13-17-10-12-27-15-17)9-8-19-24-18-7-4-11-22-21(18)25(19)14-16-5-2-1-3-6-16/h1-7,10-12,15H,8-9,13-14H2,(H,23,26) |
| InChIKey | GWGGWUVRNOMHPR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(thiophen-3-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(thiophen-3-ylmethyl)propanamide?
The IUPAC name of 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(thiophen-3-ylmethyl)propanamide (CID 134156757) is 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(thiophen-3-ylmethyl)propanamide.
What is the SMILES notation for 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(thiophen-3-ylmethyl)propanamide?
The canonical SMILES for 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(thiophen-3-ylmethyl)propanamide is O=C(CCc1nc2cccnc2n1Cc1ccccc1)NCc1ccsc1.
What is the InChIKey of 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(thiophen-3-ylmethyl)propanamide?
The InChIKey is GWGGWUVRNOMHPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4OS/c26-20(23-13-17-10-12-27-15-17)9-8-19-24-18-7-4-11-22-21(18)25(19)14-16-5-2-1-3-6-16/h1-7,10-12,15H,8-9,13-14H2,(H,23,26).
What are the key properties of 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(thiophen-3-ylmethyl)propanamide?
3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(thiophen-3-ylmethyl)propanamide has a molecular weight of 376.49 g/mol, XLogP of 3.79, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(thiophen-3-ylmethyl)propanamide is sourced from PubChem (CID 134156757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).