About methyl (Z)-12-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]octadec-9-enoate
methyl (Z)-12-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]octadec-9-enoate (PubChem CID 134156866) has the molecular formula C25H48N2O3
and a molecular weight of 424.67 g/mol. Its IUPAC name is methyl (Z)-12-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]octadec-9-enoate.
Molecular Properties
| Compound Name | methyl (Z)-12-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]octadec-9-enoate |
| PubChem CID | 134156866 |
| Molecular Formula | C25H48N2O3 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.37 |
| IUPAC Name | methyl (Z)-12-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]octadec-9-enoate |
| SMILES | CCCCCCC(C/C=C\CCCCCCCC(=O)OC)NC(=O)[C@@H](N)[C@@H](C)CC |
| InChI | InChI=1S/C25H48N2O3/c1-5-7-8-15-18-22(27-25(29)24(26)21(3)6-2)19-16-13-11-9-10-12-14-17-20-23(28)30-4/h13,16,21-22,24H,5-12,14-15,17-20,26H2,1-4H3,(H,27,29)/b16-13-/t21-,22?,24-/m0/s1 |
| InChIKey | HZWHYHHHTXKWID-YZNHQVIWSA-N |
| XLogP | 5.66 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-12-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-12-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]octadec-9-enoate?
The IUPAC name of methyl (Z)-12-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]octadec-9-enoate (CID 134156866) is methyl (Z)-12-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]octadec-9-enoate.
What is the SMILES notation for methyl (Z)-12-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]octadec-9-enoate?
The canonical SMILES for methyl (Z)-12-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]octadec-9-enoate is CCCCCCC(C/C=C\CCCCCCCC(=O)OC)NC(=O)[C@@H](N)[C@@H](C)CC.
What is the InChIKey of methyl (Z)-12-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]octadec-9-enoate?
The InChIKey is HZWHYHHHTXKWID-YZNHQVIWSA-N. The full InChI is InChI=1S/C25H48N2O3/c1-5-7-8-15-18-22(27-25(29)24(26)21(3)6-2)19-16-13-11-9-10-12-14-17-20-23(28)30-4/h13,16,21-22,24H,5-12,14-15,17-20,26H2,1-4H3,(H,27,29)/b16-13-/t21-,22?,24-/m0/s1.
What are the key properties of methyl (Z)-12-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]octadec-9-enoate?
methyl (Z)-12-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]octadec-9-enoate has a molecular weight of 424.67 g/mol, XLogP of 5.66, 19 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-12-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]octadec-9-enoate is sourced from PubChem (CID 134156866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).