C32H32ClN3O4 — CID 134156956
17-methoxy-16-[(1-pentylbenzimidazol-2-yl)methoxy]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride (PubChem CID 134156956) has the molecular formula C32H32ClN3O4 and a molecular weight of 558.08 g/mol. Its IUPAC name is 17-methoxy-16-[(1-pentylbenzimidazol-2-yl)methoxy]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride.
| Compound Name | 17-methoxy-16-[(1-pentylbenzimidazol-2-yl)methoxy]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride |
|---|---|
| PubChem CID | 134156956 |
| Molecular Formula | C32H32ClN3O4 |
| Molecular Weight | 558.08 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | 17-methoxy-16-[(1-pentylbenzimidazol-2-yl)methoxy]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride |
| SMILES | CCCCCn1c(COc2c(OC)ccc3cc4[n+](cc23)CCc2cc3c(cc2-4)OCO3)nc2ccccc21.[Cl-] |
| InChI | InChI=1S/C32H32N3O4.ClH/c1-3-4-7-13-35-26-9-6-5-8-25(26)33-31(35)19-37-32-24-18-34-14-12-22-16-29-30(39-20-38-29)17-23(22)27(34)15-21(24)10-11-28(32)36-2;/h5-6,8-11,15-18H,3-4,7,12-14,19-20H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | PDLGDSQAFFKWMY-UHFFFAOYSA-M |
| XLogP | 3.21 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.08 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|