C17H20N2O4 — CID 134156981
4-phenyl-N'-[(2,3,4-trihydroxyphenyl)methyl]butanehydrazide (PubChem CID 134156981) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-phenyl-N'-[(2,3,4-trihydroxyphenyl)methyl]butanehydrazide.
| Compound Name | 4-phenyl-N'-[(2,3,4-trihydroxyphenyl)methyl]butanehydrazide |
|---|---|
| PubChem CID | 134156981 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-phenyl-N'-[(2,3,4-trihydroxyphenyl)methyl]butanehydrazide |
| SMILES | O=C(CCCc1ccccc1)NNCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C17H20N2O4/c20-14-10-9-13(16(22)17(14)23)11-18-19-15(21)8-4-7-12-5-2-1-3-6-12/h1-3,5-6,9-10,18,20,22-23H,4,7-8,11H2,(H,19,21) |
| InChIKey | NTCICMNOGGQAPU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|