C31H30N4O5 — CID 134157542
3-[2-[[(16E)-14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaen-11-yl]oxy]ethylamino]benzoic acid (PubChem CID 134157542) has the molecular formula C31H30N4O5 and a molecular weight of 538.60 g/mol. Its IUPAC name is 3-[2-[[(16E)-14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaen-11-yl]oxy]ethylamino]benzoic acid.
| Compound Name | 3-[2-[[(16E)-14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaen-11-yl]oxy]ethylamino]benzoic acid |
|---|---|
| PubChem CID | 134157542 |
| Molecular Formula | C31H30N4O5 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 3-[2-[[(16E)-14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaen-11-yl]oxy]ethylamino]benzoic acid |
| SMILES | O=C(O)c1cccc(NCCOc2ccc3cc2COC/C=C/COCc2cccc(c2)-c2ccnc(n2)N3)c1 |
| InChI | InChI=1S/C31H30N4O5/c36-30(37)24-7-4-8-26(18-24)32-13-16-40-29-10-9-27-19-25(29)21-39-15-2-1-14-38-20-22-5-3-6-23(17-22)28-11-12-33-31(34-27)35-28/h1-12,17-19,32H,13-16,20-21H2,(H,36,37)(H,33,34,35)/b2-1+ |
| InChIKey | RLNHDPUVCRDNQW-OWOJBTEDSA-N |
| XLogP | 5.68 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|