C21H20N2O3 — CID 134157566
21-methoxy-5,7-dioxa-13,16-diazahexacyclo[11.11.0.02,10.04,8.015,23.017,22]tetracosa-2,4(8),9,15(23),17(22),18,20-heptaene (PubChem CID 134157566) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 21-methoxy-5,7-dioxa-13,16-diazahexacyclo[11.11.0.02,10.04,8.015,23.017,22]tetracosa-2,4(8),9,15(23),17(22),18,20-heptaene.
| Compound Name | 21-methoxy-5,7-dioxa-13,16-diazahexacyclo[11.11.0.02,10.04,8.015,23.017,22]tetracosa-2,4(8),9,15(23),17(22),18,20-heptaene |
|---|---|
| PubChem CID | 134157566 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 21-methoxy-5,7-dioxa-13,16-diazahexacyclo[11.11.0.02,10.04,8.015,23.017,22]tetracosa-2,4(8),9,15(23),17(22),18,20-heptaene |
| SMILES | COc1cccc2[nH]c3c(c12)CC1c2cc4c(cc2CCN1C3)OCO4 |
| InChI | InChI=1S/C21H20N2O3/c1-24-18-4-2-3-15-21(18)14-8-17-13-9-20-19(25-11-26-20)7-12(13)5-6-23(17)10-16(14)22-15/h2-4,7,9,17,22H,5-6,8,10-11H2,1H3 |
| InChIKey | BUYJSSDFOQMYKS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |