C13H17NO4 — CID 134157694
(3aR,4S,7R,7aS)-3a,7a-dimethyl-2-(2-oxopropyl)-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 134157694) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is (3aR,4S,7R,7aS)-3a,7a-dimethyl-2-(2-oxopropyl)-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4S,7R,7aS)-3a,7a-dimethyl-2-(2-oxopropyl)-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 134157694 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (3aR,4S,7R,7aS)-3a,7a-dimethyl-2-(2-oxopropyl)-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CC(=O)CN1C(=O)[C@@]2(C)[C@@H]3CC[C@@H](O3)[C@@]2(C)C1=O |
| InChI | InChI=1S/C13H17NO4/c1-7(15)6-14-10(16)12(2)8-4-5-9(18-8)13(12,3)11(14)17/h8-9H,4-6H2,1-3H3/t8-,9+,12+,13- |
| InChIKey | GIQHOYHNWFGMLL-JDNZLRHBSA-N |
| XLogP | 0.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|