C13H15N5OS — CID 134157761
5-N-butyl-2-(furan-2-yl)-[1,3]thiazolo[5,4-d]pyrimidine-5,7-diamine (PubChem CID 134157761) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is 5-N-butyl-2-(furan-2-yl)-[1,3]thiazolo[5,4-d]pyrimidine-5,7-diamine.
| Compound Name | 5-N-butyl-2-(furan-2-yl)-[1,3]thiazolo[5,4-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 134157761 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 5-N-butyl-2-(furan-2-yl)-[1,3]thiazolo[5,4-d]pyrimidine-5,7-diamine |
| SMILES | CCCCNc1nc(N)c2nc(-c3ccco3)sc2n1 |
| InChI | InChI=1S/C13H15N5OS/c1-2-3-6-15-13-17-10(14)9-12(18-13)20-11(16-9)8-5-4-7-19-8/h4-5,7H,2-3,6H2,1H3,(H3,14,15,17,18) |
| InChIKey | OCYRRIUPJYARRC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|