C34H47N3O6 — CID 134157899
ethyl (1S,4S,5R,9S,10S,13S,14R,15R)-15-[[4-[(4-formyl-2-methoxyphenoxy)methyl]triazol-1-yl]methyl]-14-hydroxy-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 134157899) has the molecular formula C34H47N3O6 and a molecular weight of 593.77 g/mol. Its IUPAC name is ethyl (1S,4S,5R,9S,10S,13S,14R,15R)-15-[[4-[(4-formyl-2-methoxyphenoxy)methyl]triazol-1-yl]methyl]-14-hydroxy-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | ethyl (1S,4S,5R,9S,10S,13S,14R,15R)-15-[[4-[(4-formyl-2-methoxyphenoxy)methyl]triazol-1-yl]methyl]-14-hydroxy-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 134157899 |
| Molecular Formula | C34H47N3O6 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.35 |
| IUPAC Name | ethyl (1S,4S,5R,9S,10S,13S,14R,15R)-15-[[4-[(4-formyl-2-methoxyphenoxy)methyl]triazol-1-yl]methyl]-14-hydroxy-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)[C@H](Cn1cc(COc2ccc(C=O)cc2OC)nn1)[C@H]4O |
| InChI | InChI=1S/C34H47N3O6/c1-6-42-30(40)33(4)13-7-12-32(3)27(33)11-15-34-21-31(2,14-10-28(32)34)29(39)24(34)18-37-17-23(35-36-37)20-43-25-9-8-22(19-38)16-26(25)41-5/h8-9,16-17,19,24,27-29,39H,6-7,10-15,18,20-21H2,1-5H3/t24-,27+,28+,29-,31+,32-,33-,34-/m1/s1 |
| InChIKey | IQZZDXDSTNGBPF-LXOMTDKCSA-N |
| XLogP | 5.63 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|