About (Z)-2-(3,5-dimethoxyphenyl)-3-(3-ethoxyphenyl)prop-2-enenitrile
(Z)-2-(3,5-dimethoxyphenyl)-3-(3-ethoxyphenyl)prop-2-enenitrile (PubChem CID 134158015) has the molecular formula C19H19NO3
and a molecular weight of 309.37 g/mol. Its IUPAC name is (Z)-2-(3,5-dimethoxyphenyl)-3-(3-ethoxyphenyl)prop-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-2-(3,5-dimethoxyphenyl)-3-(3-ethoxyphenyl)prop-2-enenitrile |
| PubChem CID | 134158015 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (Z)-2-(3,5-dimethoxyphenyl)-3-(3-ethoxyphenyl)prop-2-enenitrile |
| SMILES | CCOc1cccc(/C=C(\C#N)c2cc(OC)cc(OC)c2)c1 |
| InChI | InChI=1S/C19H19NO3/c1-4-23-17-7-5-6-14(9-17)8-16(13-20)15-10-18(21-2)12-19(11-15)22-3/h5-12H,4H2,1-3H3/b16-8+ |
| InChIKey | SIMCTANWCXZNJU-LZYBPNLTSA-N |
| XLogP | 4.17 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(3,5-dimethoxyphenyl)-3-(3-ethoxyphenyl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(3,5-dimethoxyphenyl)-3-(3-ethoxyphenyl)prop-2-enenitrile?
The IUPAC name of (Z)-2-(3,5-dimethoxyphenyl)-3-(3-ethoxyphenyl)prop-2-enenitrile (CID 134158015) is (Z)-2-(3,5-dimethoxyphenyl)-3-(3-ethoxyphenyl)prop-2-enenitrile.
What is the SMILES notation for (Z)-2-(3,5-dimethoxyphenyl)-3-(3-ethoxyphenyl)prop-2-enenitrile?
The canonical SMILES for (Z)-2-(3,5-dimethoxyphenyl)-3-(3-ethoxyphenyl)prop-2-enenitrile is CCOc1cccc(/C=C(\C#N)c2cc(OC)cc(OC)c2)c1.
What is the InChIKey of (Z)-2-(3,5-dimethoxyphenyl)-3-(3-ethoxyphenyl)prop-2-enenitrile?
The InChIKey is SIMCTANWCXZNJU-LZYBPNLTSA-N. The full InChI is InChI=1S/C19H19NO3/c1-4-23-17-7-5-6-14(9-17)8-16(13-20)15-10-18(21-2)12-19(11-15)22-3/h5-12H,4H2,1-3H3/b16-8+.
What are the key properties of (Z)-2-(3,5-dimethoxyphenyl)-3-(3-ethoxyphenyl)prop-2-enenitrile?
(Z)-2-(3,5-dimethoxyphenyl)-3-(3-ethoxyphenyl)prop-2-enenitrile has a molecular weight of 309.37 g/mol, XLogP of 4.17, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(3,5-dimethoxyphenyl)-3-(3-ethoxyphenyl)prop-2-enenitrile is sourced from PubChem (CID 134158015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).