C20H35N3O2 — CID 134158062
4-[(1S,4R,6S,10R)-10-methyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-en-6-yl]butyl hexanoate (PubChem CID 134158062) has the molecular formula C20H35N3O2 and a molecular weight of 349.52 g/mol. Its IUPAC name is 4-[(1S,4R,6S,10R)-10-methyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-en-6-yl]butyl hexanoate.
| Compound Name | 4-[(1S,4R,6S,10R)-10-methyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-en-6-yl]butyl hexanoate |
|---|---|
| PubChem CID | 134158062 |
| Molecular Formula | C20H35N3O2 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.27 |
| IUPAC Name | 4-[(1S,4R,6S,10R)-10-methyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-en-6-yl]butyl hexanoate |
| SMILES | CCCCCC(=O)OCCCC[C@H]1C[C@H]2CC[C@H]3C[C@@H](C)NC(=N1)N23 |
| InChI | InChI=1S/C20H35N3O2/c1-3-4-5-9-19(24)25-12-7-6-8-16-14-18-11-10-17-13-15(2)21-20(22-16)23(17)18/h15-18H,3-14H2,1-2H3,(H,21,22)/t15-,16+,17+,18-/m1/s1 |
| InChIKey | FVASSAAZWIRTDK-VSZNYVQBSA-N |
| XLogP | 3.62 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|