C12H12F2N4O — CID 134158221
2-[[2-(3,4-difluoroanilino)pyrimidin-4-yl]amino]ethanol (PubChem CID 134158221) has the molecular formula C12H12F2N4O and a molecular weight of 266.25 g/mol. Its IUPAC name is 2-[[2-(3,4-difluoroanilino)pyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[[2-(3,4-difluoroanilino)pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 134158221 |
| Molecular Formula | C12H12F2N4O |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2-[[2-(3,4-difluoroanilino)pyrimidin-4-yl]amino]ethanol |
| SMILES | OCCNc1ccnc(Nc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C12H12F2N4O/c13-9-2-1-8(7-10(9)14)17-12-16-4-3-11(18-12)15-5-6-19/h1-4,7,19H,5-6H2,(H2,15,16,17,18) |
| InChIKey | FPBMWXUQBZXXDH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |