About 2-[[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]amino]ethanol
2-[[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]amino]ethanol (PubChem CID 134158275) has the molecular formula C13H14F2N4O
and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]amino]ethanol |
| PubChem CID | 134158275 |
| Molecular Formula | C13H14F2N4O |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-[[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]amino]ethanol |
| SMILES | Cc1cc(NCCO)nc(Nc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C13H14F2N4O/c1-8-6-12(16-4-5-20)19-13(17-8)18-9-2-3-10(14)11(15)7-9/h2-3,6-7,20H,4-5H2,1H3,(H2,16,17,18,19) |
| InChIKey | WZSVDHRNNCSAQL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]amino]ethanol?
The IUPAC name of 2-[[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]amino]ethanol (CID 134158275) is 2-[[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]amino]ethanol.
What is the SMILES notation for 2-[[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]amino]ethanol?
The canonical SMILES for 2-[[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]amino]ethanol is Cc1cc(NCCO)nc(Nc2ccc(F)c(F)c2)n1.
What is the InChIKey of 2-[[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]amino]ethanol?
The InChIKey is WZSVDHRNNCSAQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N4O/c1-8-6-12(16-4-5-20)19-13(17-8)18-9-2-3-10(14)11(15)7-9/h2-3,6-7,20H,4-5H2,1H3,(H2,16,17,18,19).
What are the key properties of 2-[[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]amino]ethanol?
2-[[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]amino]ethanol has a molecular weight of 280.28 g/mol, XLogP of 2.21, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(3,4-difluoroanilino)-6-methylpyrimidin-4-yl]amino]ethanol is sourced from PubChem (CID 134158275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).